mirror of
https://github.com/ryujinx-mirror/ryujinx.git
synced 2025-10-09 23:25:50 -05:00
Add Profiled Persistent Translation Cache. (#769)
* Delete DelegateTypes.cs * Delete DelegateCache.cs * Add files via upload * Update Horizon.cs * Update Program.cs * Update MainWindow.cs * Update Aot.cs * Update RelocEntry.cs * Update Translator.cs * Update MemoryManager.cs * Update InstEmitMemoryHelper.cs * Update Delegates.cs * Nit. * Nit. * Nit. * 10 fewer MSIL bytes for us * Add comment. Nits. * Update Translator.cs * Update Aot.cs * Nits. * Opt.. * Opt.. * Opt.. * Opt.. * Allow to change compression level. * Update MemoryManager.cs * Update Translator.cs * Manage corner cases during the save phase. Nits. * Update Aot.cs * Translator response tweak for Aot disabled. Nit. * Nit. * Nits. * Create DelegateHelpers.cs * Update Delegates.cs * Nit. * Nit. * Nits. * Fix due to #784. * Fixes due to #757 & #841. * Fix due to #846. * Fix due to #847. * Use MethodInfo for managed method calls. Use IR methods instead of managed methods about Max/Min (S/U). Follow-ups & Nits. * Add missing exception messages. Reintroduce slow path for Fmov_Vi. Implement slow path for Fmov_Si. * Switch to the new folder structure. Nits. * Impl. index-based relocation information. Impl. cache file version field. * Nit. * Address gdkchan comments. Mainly: - fixed cache file corruption issue on exit; - exposed a way to disable AOT on the GUI. * Address AcK77 comment. * Address Thealexbarney, jduncanator & emmauss comments. Header magic, CpuId (FI) & Aot -> Ptc. * Adaptation to the new application reloading system. Improvements to the call system of managed methods. Follow-ups. Nits. * Get the same boot times as on master when PTC is disabled. * Profiled Aot. * A32 support (#897). * #975 support (1 of 2). * #975 support (2 of 2). * Rebase fix & nits. * Some fixes and nits (still one bug left). * One fix & nits. * Tests fix (by gdk) & nits. * Support translations not only in high quality and rejit. Nits. * Added possibility to skip translations and continue execution, using `ESC` key. * Update SettingsWindow.cs * Update GLRenderer.cs * Update Ptc.cs * Disabled Profiled PTC by default as requested in the past by gdk. * Fix rejit bug. Increased number of parallel translations. Add stack unwinding stuffs support (1 of 2). Nits. * Add stack unwinding stuffs support (2 of 2). Tuned number of parallel translations. * Restored the ability to assemble jumps with 8-bit offset when Profiled PTC is disabled or during profiling. Modifications due to rebase. Nits. * Limited profiling of the functions to be translated to the addresses belonging to the range of static objects only. * Nits. * Nits. * Update Delegates.cs * Nit. * Update InstEmitSimdArithmetic.cs * Address riperiperi comments. * Fixed the issue of unjustifiably longer boot times at the second boot than at the first boot, measured at the same time or reference point and with the same number of translated functions. * Implemented a simple redundant load/save mechanism. Halved the value of Decoder.MaxInstsPerFunction more appropriate for the current performance of the Translator. Replaced by Logger.PrintError to Logger.PrintDebug in TexturePool.cs about the supposed invalid texture format to avoid the spawn of the log. Nits. * Nit. Improved Logger.PrintError in TexturePool.cs to avoid log spawn. Added missing code for FZ handling (in output) for fp max/min instructions (slow paths). * Add configuration migration for PTC Co-authored-by: Thog <me@thog.eu>
This commit is contained in:
@@ -1,5 +1,5 @@
|
||||
{
|
||||
"version": 7,
|
||||
"version": 8,
|
||||
"max_anisotropy": -1,
|
||||
"graphics_shaders_dump_path": "",
|
||||
"logging_enable_debug": false,
|
||||
@@ -19,6 +19,7 @@
|
||||
"enable_discord_integration": true,
|
||||
"enable_vsync": true,
|
||||
"enable_multicore_scheduling": true,
|
||||
"enable_ptc": false,
|
||||
"enable_fs_integrity_checks": true,
|
||||
"fs_global_access_log_mode": 0,
|
||||
"ignore_missing_services": false,
|
||||
|
@@ -1,3 +1,4 @@
|
||||
using ARMeilleure.Translation.PTC;
|
||||
using Gtk;
|
||||
using Ryujinx.Common.Logging;
|
||||
using Ryujinx.Common.SystemInfo;
|
||||
@@ -110,10 +111,16 @@ namespace Ryujinx
|
||||
|
||||
Logger.PrintError(LogClass.Application, $"Unhandled exception caught: {exception}");
|
||||
|
||||
Ptc.Close();
|
||||
PtcProfiler.Stop();
|
||||
|
||||
if (e.IsTerminating)
|
||||
{
|
||||
Logger.Shutdown();
|
||||
|
||||
Ptc.Dispose();
|
||||
PtcProfiler.Dispose();
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
@@ -1,3 +1,4 @@
|
||||
using ARMeilleure.Translation.PTC;
|
||||
using Gdk;
|
||||
using OpenTK;
|
||||
using OpenTK.Graphics;
|
||||
@@ -183,8 +184,8 @@ namespace Ryujinx.Ui
|
||||
string titleNameSection = string.IsNullOrWhiteSpace(_device.Application.TitleName) ? string.Empty
|
||||
: $" - {_device.Application.TitleName}";
|
||||
|
||||
string titleVersionSection = string.IsNullOrWhiteSpace(_device.Application.TitleVersionString) ? string.Empty
|
||||
: $" v{_device.Application.TitleVersionString}";
|
||||
string titleVersionSection = string.IsNullOrWhiteSpace(_device.Application.DisplayVersion) ? string.Empty
|
||||
: $" v{_device.Application.DisplayVersion}";
|
||||
|
||||
string titleIdSection = string.IsNullOrWhiteSpace(_device.Application.TitleIdText) ? string.Empty
|
||||
: $" ({_device.Application.TitleIdText.ToUpper()})";
|
||||
@@ -378,7 +379,17 @@ namespace Ryujinx.Ui
|
||||
{
|
||||
Gtk.Application.Invoke(delegate
|
||||
{
|
||||
HandleScreenState(OpenTK.Input.Keyboard.GetState());
|
||||
KeyboardState keyboard = OpenTK.Input.Keyboard.GetState();
|
||||
|
||||
HandleScreenState(keyboard);
|
||||
|
||||
if (keyboard.IsKeyDown(OpenTK.Input.Key.Delete))
|
||||
{
|
||||
if (!ParentWindow.State.HasFlag(Gdk.WindowState.Fullscreen))
|
||||
{
|
||||
Ptc.Continue();
|
||||
}
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
|
@@ -1,3 +1,4 @@
|
||||
using ARMeilleure.Translation.PTC;
|
||||
using Gtk;
|
||||
using LibHac.Common;
|
||||
using LibHac.Ns;
|
||||
@@ -470,6 +471,9 @@ namespace Ryujinx.Ui
|
||||
|
||||
_glWidget.Start();
|
||||
|
||||
Ptc.Close();
|
||||
PtcProfiler.Stop();
|
||||
|
||||
device.Dispose();
|
||||
_deviceExitStatus.Set();
|
||||
|
||||
@@ -597,6 +601,10 @@ namespace Ryujinx.Ui
|
||||
Profile.FinishProfiling();
|
||||
DiscordIntegrationModule.Exit();
|
||||
Logger.Shutdown();
|
||||
|
||||
Ptc.Dispose();
|
||||
PtcProfiler.Dispose();
|
||||
|
||||
Application.Quit();
|
||||
}
|
||||
|
||||
|
@@ -35,6 +35,7 @@ namespace Ryujinx.Ui
|
||||
[GUI] CheckButton _discordToggle;
|
||||
[GUI] CheckButton _vSyncToggle;
|
||||
[GUI] CheckButton _multiSchedToggle;
|
||||
[GUI] CheckButton _ptcToggle;
|
||||
[GUI] CheckButton _fsicToggle;
|
||||
[GUI] CheckButton _ignoreToggle;
|
||||
[GUI] CheckButton _directKeyboardAccess;
|
||||
@@ -152,6 +153,11 @@ namespace Ryujinx.Ui
|
||||
_multiSchedToggle.Click();
|
||||
}
|
||||
|
||||
if (ConfigurationState.Instance.System.EnablePtc)
|
||||
{
|
||||
_ptcToggle.Click();
|
||||
}
|
||||
|
||||
if (ConfigurationState.Instance.System.EnableFsIntegrityChecks)
|
||||
{
|
||||
_fsicToggle.Click();
|
||||
@@ -381,6 +387,7 @@ namespace Ryujinx.Ui
|
||||
ConfigurationState.Instance.EnableDiscordIntegration.Value = _discordToggle.Active;
|
||||
ConfigurationState.Instance.Graphics.EnableVsync.Value = _vSyncToggle.Active;
|
||||
ConfigurationState.Instance.System.EnableMulticoreScheduling.Value = _multiSchedToggle.Active;
|
||||
ConfigurationState.Instance.System.EnablePtc.Value = _ptcToggle.Active;
|
||||
ConfigurationState.Instance.System.EnableFsIntegrityChecks.Value = _fsicToggle.Active;
|
||||
ConfigurationState.Instance.System.IgnoreMissingServices.Value = _ignoreToggle.Active;
|
||||
ConfigurationState.Instance.Hid.EnableKeyboard.Value = _directKeyboardAccess.Active;
|
||||
|
@@ -1398,6 +1398,24 @@
|
||||
<property name="position">5</property>
|
||||
</packing>
|
||||
</child>
|
||||
<child>
|
||||
<object class="GtkCheckButton" id="_ptcToggle">
|
||||
<property name="label" translatable="yes">Enable Profiled Persistent Translation Cache</property>
|
||||
<property name="visible">True</property>
|
||||
<property name="can_focus">True</property>
|
||||
<property name="receives_default">False</property>
|
||||
<property name="tooltip_text" translatable="yes">Enables or disables profiled translation cache persistency</property>
|
||||
<property name="halign">start</property>
|
||||
<property name="margin_top">5</property>
|
||||
<property name="margin_bottom">5</property>
|
||||
<property name="draw_indicator">True</property>
|
||||
</object>
|
||||
<packing>
|
||||
<property name="expand">False</property>
|
||||
<property name="fill">True</property>
|
||||
<property name="position">6</property>
|
||||
</packing>
|
||||
</child>
|
||||
<child>
|
||||
<object class="GtkCheckButton" id="_fsicToggle">
|
||||
<property name="label" translatable="yes">Enable FS Integrity Checks</property>
|
||||
@@ -1413,7 +1431,7 @@
|
||||
<packing>
|
||||
<property name="expand">False</property>
|
||||
<property name="fill">True</property>
|
||||
<property name="position">6</property>
|
||||
<property name="position">7</property>
|
||||
</packing>
|
||||
</child>
|
||||
</object>
|
||||
|
@@ -19,6 +19,7 @@
|
||||
"docked_mode",
|
||||
"enable_vsync",
|
||||
"enable_multicore_scheduling",
|
||||
"enable_ptc",
|
||||
"enable_fs_integrity_checks",
|
||||
"fs_global_access_log_mode",
|
||||
"controller_type",
|
||||
@@ -478,6 +479,17 @@
|
||||
false
|
||||
]
|
||||
},
|
||||
"enable_ptc": {
|
||||
"$id": "#/properties/enable_ptc",
|
||||
"type": "boolean",
|
||||
"title": "Enable Profiled Persistent Translation Cache",
|
||||
"description": "Enables or disables profiled translation cache persistency",
|
||||
"default": false,
|
||||
"examples": [
|
||||
true,
|
||||
false
|
||||
]
|
||||
},
|
||||
"enable_fs_integrity_checks": {
|
||||
"$id": "#/properties/enable_fs_integrity_checks",
|
||||
"type": "boolean",
|
||||
@@ -581,7 +593,7 @@
|
||||
"$id": "#/properties/enable_keyboard",
|
||||
"type": "boolean",
|
||||
"title": "(HID) Keyboard Enable",
|
||||
"description": "Enable or disable direct keyboard access (HID) support (Provides games access to your keyboard as a text entry device).",
|
||||
"description": "Enable or disable direct keyboard access (HID) support (Provides games access to your keyboard as a text entry device)",
|
||||
"default": true,
|
||||
"examples": [
|
||||
true,
|
||||
|
Reference in New Issue
Block a user